C17H19ClN2O4 — CID 7822161
[(1S)-1-(2-chlorophenyl)ethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7822161) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7822161 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | C[C@H](OC(=O)CN1C(=O)NC2(CCCC2)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN2O4/c1-11(12-6-2-3-7-13(12)18)24-14(21)10-20-15(22)17(19-16(20)23)8-4-5-9-17/h2-3,6-7,11H,4-5,8-10H2,1H3,(H,19,23)/t11-/m0/s1 |
| InChIKey | QADFVBWAHUPKPW-NSHDSACASA-N |
| XLogP | 2.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|