C17H18BrFN2O4 — CID 55341150
(4-bromo-2-fluorophenyl) 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55341150) has the molecular formula C17H18BrFN2O4 and a molecular weight of 413.24 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | (4-bromo-2-fluorophenyl) 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55341150 |
| Molecular Formula | C17H18BrFN2O4 |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)Oc1ccc(Br)cc1F)C2=O |
| InChI | InChI=1S/C17H18BrFN2O4/c1-10-4-6-17(7-5-10)15(23)21(16(24)20-17)9-14(22)25-13-3-2-11(18)8-12(13)19/h2-3,8,10H,4-7,9H2,1H3,(H,20,24) |
| InChIKey | WTFUEDLCFQXFKB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|