C19H23BrN2O5 — CID 47093906
2-(4-bromophenoxy)ethyl 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 47093906) has the molecular formula C19H23BrN2O5 and a molecular weight of 439.31 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | 2-(4-bromophenoxy)ethyl 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 47093906 |
| Molecular Formula | C19H23BrN2O5 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)OCCOc1ccc(Br)cc1)C2=O |
| InChI | InChI=1S/C19H23BrN2O5/c1-13-6-8-19(9-7-13)17(24)22(18(25)21-19)12-16(23)27-11-10-26-15-4-2-14(20)3-5-15/h2-5,13H,6-12H2,1H3,(H,21,25) |
| InChIKey | ZWEWHXPIRAOSFJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|