C17H21BrN2O5 — CID 8703261
2-(4-bromophenoxy)ethyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 8703261) has the molecular formula C17H21BrN2O5 and a molecular weight of 413.27 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | 2-(4-bromophenoxy)ethyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 8703261 |
| Molecular Formula | C17H21BrN2O5 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)OCCOc2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C17H21BrN2O5/c1-17(2)15(22)20(16(23)19-17)9-3-4-14(21)25-11-10-24-13-7-5-12(18)6-8-13/h5-8H,3-4,9-11H2,1-2H3,(H,19,23) |
| InChIKey | UWUDNHCYJPUNOF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|