C17H19FN2O5 — CID 8677358
[2-(3-fluorophenyl)-2-oxoethyl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 8677358) has the molecular formula C17H19FN2O5 and a molecular weight of 350.35 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 8677358 |
| Molecular Formula | C17H19FN2O5 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)OCC(=O)c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C17H19FN2O5/c1-17(2)15(23)20(16(24)19-17)8-4-7-14(22)25-10-13(21)11-5-3-6-12(18)9-11/h3,5-6,9H,4,7-8,10H2,1-2H3,(H,19,24) |
| InChIKey | HZBQMBNKJRHABT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|