C16H17FN2O5 — CID 8807150
[2-(3-fluorophenyl)-2-oxoethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate (PubChem CID 8807150) has the molecular formula C16H17FN2O5 and a molecular weight of 336.32 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 8807150 |
| Molecular Formula | C16H17FN2O5 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
| SMILES | CC1(C)NC(=O)N(CCC(=O)OCC(=O)c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C16H17FN2O5/c1-16(2)14(22)19(15(23)18-16)7-6-13(21)24-9-12(20)10-4-3-5-11(17)8-10/h3-5,8H,6-7,9H2,1-2H3,(H,18,23) |
| InChIKey | GXWSGHQJPBXXEO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|