C15H17N3O3S — CID 4878898
N-benzyl-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)acetamide (PubChem CID 4878898) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-benzyl-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)acetamide.
| Compound Name | N-benzyl-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
|---|---|
| PubChem CID | 4878898 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-benzyl-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCSC2)C1=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H17N3O3S/c19-12(16-8-11-4-2-1-3-5-11)9-18-13(20)15(17-14(18)21)6-7-22-10-15/h1-5H,6-10H2,(H,16,19)(H,17,21) |
| InChIKey | HWFUJODZTCLNCE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|