C12H16N4O4S — CID 42979279
2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 42979279) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 42979279 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CN1C(=O)NC2(CCSC2)C1=O |
| InChI | InChI=1S/C12H16N4O4S/c1-2-4-13-10(19)14-8(17)6-16-9(18)12(15-11(16)20)3-5-21-7-12/h2H,1,3-7H2,(H,15,20)(H2,13,14,17,19) |
| InChIKey | UDNDJJSWCYQOFI-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|