C14H20N4O3S — CID 42979278
N-(2-cyano-3-methylbutan-2-yl)-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)acetamide (PubChem CID 42979278) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is N-(2-cyano-3-methylbutan-2-yl)-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)acetamide.
| Compound Name | N-(2-cyano-3-methylbutan-2-yl)-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
|---|---|
| PubChem CID | 42979278 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-(2-cyano-3-methylbutan-2-yl)-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
| SMILES | CC(C)C(C)(C#N)NC(=O)CN1C(=O)NC2(CCSC2)C1=O |
| InChI | InChI=1S/C14H20N4O3S/c1-9(2)13(3,7-15)16-10(19)6-18-11(20)14(17-12(18)21)4-5-22-8-14/h9H,4-6,8H2,1-3H3,(H,16,19)(H,17,21) |
| InChIKey | KUCJBYWWMMKDMQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|