C16H16Cl2N4O4 — CID 4804693
2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 4804693) has the molecular formula C16H16Cl2N4O4 and a molecular weight of 399.23 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 4804693 |
| Molecular Formula | C16H16Cl2N4O4 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CN1C(=O)NC(C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C16H16Cl2N4O4/c1-3-6-19-14(25)20-12(23)8-22-13(24)16(2,21-15(22)26)10-5-4-9(17)7-11(10)18/h3-5,7H,1,6,8H2,2H3,(H,21,26)(H2,19,20,23,25) |
| InChIKey | UWINPYQMMLMSPX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|