C22H23N3O3S — CID 42979649
N-benzhydryl-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)-N-methylacetamide (PubChem CID 42979649) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-benzhydryl-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)-N-methylacetamide.
| Compound Name | N-benzhydryl-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 42979649 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-benzhydryl-2-(2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)NC2(CCSC2)C1=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-24(19(16-8-4-2-5-9-16)17-10-6-3-7-11-17)18(26)14-25-20(27)22(23-21(25)28)12-13-29-15-22/h2-11,19H,12-15H2,1H3,(H,23,28) |
| InChIKey | PLNHWGYCLZQQDU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|