C20H23F3N2O4 — CID 51611832
2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]acetamide (PubChem CID 51611832) has the molecular formula C20H23F3N2O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 51611832 |
| Molecular Formula | C20H23F3N2O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2CCCC[C@H]2C1=O)NCc1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N2O4/c21-20(22,23)12-29-11-14-7-5-13(6-8-14)9-24-17(26)10-25-18(27)15-3-1-2-4-16(15)19(25)28/h5-8,15-16H,1-4,9-12H2,(H,24,26)/t15-,16-/m1/s1 |
| InChIKey | BPWZROMSOHYZFY-HZPDHXFCSA-N |
| XLogP | 2.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|