C22H19N3O5 — CID 22109916
[1-(4-cyanoanilino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 22109916) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is [1-(4-cyanoanilino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [1-(4-cyanoanilino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 22109916 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [1-(4-cyanoanilino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CC(OC(=O)CCCN1C(=O)c2ccccc2C1=O)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H19N3O5/c1-14(20(27)24-16-10-8-15(13-23)9-11-16)30-19(26)7-4-12-25-21(28)17-5-2-3-6-18(17)22(25)29/h2-3,5-6,8-11,14H,4,7,12H2,1H3,(H,24,27) |
| InChIKey | GRPQSSRLGYWVRG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|