C22H19N3O5 — CID 9363151
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 9363151) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 9363151 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | C[C@H](OC(=O)CCCN1C(=O)c2ccccc2C1=O)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C22H19N3O5/c1-14(20(27)24-16-7-4-6-15(12-16)13-23)30-19(26)10-5-11-25-21(28)17-8-2-3-9-18(17)22(25)29/h2-4,6-9,12,14H,5,10-11H2,1H3,(H,24,27)/t14-/m0/s1 |
| InChIKey | WRDAHCHBFNDCNO-AWEZNQCLSA-N |
| XLogP | 2.50 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|