C15H18N4O4 — CID 52532702
[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 4-(carbamoylamino)butanoate (PubChem CID 52532702) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 4-(carbamoylamino)butanoate.
| Compound Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 4-(carbamoylamino)butanoate |
|---|---|
| PubChem CID | 52532702 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 4-(carbamoylamino)butanoate |
| SMILES | C[C@H](OC(=O)CCCNC(N)=O)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H18N4O4/c1-10(23-13(20)3-2-8-18-15(17)22)14(21)19-12-6-4-11(9-16)5-7-12/h4-7,10H,2-3,8H2,1H3,(H,19,21)(H3,17,18,22)/t10-/m0/s1 |
| InChIKey | AXSVEWJNSDDSAX-JTQLQIEISA-N |
| XLogP | 0.88 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|