C25H21N3O6 — CID 24559619
methyl 5-[(E)-3-[2-[2-[4-(4-cyanophenyl)phenoxy]acetyl]hydrazinyl]-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate (PubChem CID 24559619) has the molecular formula C25H21N3O6 and a molecular weight of 459.46 g/mol. Its IUPAC name is methyl 5-[(E)-3-[2-[2-[4-(4-cyanophenyl)phenoxy]acetyl]hydrazinyl]-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(E)-3-[2-[2-[4-(4-cyanophenyl)phenoxy]acetyl]hydrazinyl]-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 24559619 |
| Molecular Formula | C25H21N3O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | methyl 5-[(E)-3-[2-[2-[4-(4-cyanophenyl)phenoxy]acetyl]hydrazinyl]-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(/C=C/C(=O)NNC(=O)COc2ccc(-c3ccc(C#N)cc3)cc2)oc1C |
| InChI | InChI=1S/C25H21N3O6/c1-16-22(25(31)32-2)13-21(34-16)11-12-23(29)27-28-24(30)15-33-20-9-7-19(8-10-20)18-5-3-17(14-26)4-6-18/h3-13H,15H2,1-2H3,(H,27,29)(H,28,30)/b12-11+ |
| InChIKey | VVIBCFVKCLXJAY-VAWYXSNFSA-N |
| XLogP | 3.15 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|