C24H18ClN3O3 — CID 24636166
(E)-3-(2-chlorophenyl)-N'-[2-[4-(4-cyanophenyl)phenoxy]acetyl]prop-2-enehydrazide (PubChem CID 24636166) has the molecular formula C24H18ClN3O3 and a molecular weight of 431.88 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N'-[2-[4-(4-cyanophenyl)phenoxy]acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(2-chlorophenyl)-N'-[2-[4-(4-cyanophenyl)phenoxy]acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 24636166 |
| Molecular Formula | C24H18ClN3O3 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N'-[2-[4-(4-cyanophenyl)phenoxy]acetyl]prop-2-enehydrazide |
| SMILES | N#Cc1ccc(-c2ccc(OCC(=O)NNC(=O)/C=C/c3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C24H18ClN3O3/c25-22-4-2-1-3-20(22)11-14-23(29)27-28-24(30)16-31-21-12-9-19(10-13-21)18-7-5-17(15-26)6-8-18/h1-14H,16H2,(H,27,29)(H,28,30)/b14-11+ |
| InChIKey | LQDJSDIPAQDEIQ-SDNWHVSQSA-N |
| XLogP | 4.12 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|