C25H23FN2O3 — CID 16558973
N-cyclopentyl-2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]benzamide (PubChem CID 16558973) has the molecular formula C25H23FN2O3 and a molecular weight of 418.47 g/mol. Its IUPAC name is N-cyclopentyl-2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 16558973 |
| Molecular Formula | C25H23FN2O3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-cyclopentyl-2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]benzamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2F)o1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C25H23FN2O3/c26-21-11-5-3-9-19(21)23-15-13-18(31-23)14-16-24(29)28-22-12-6-4-10-20(22)25(30)27-17-7-1-2-8-17/h3-6,9-17H,1-2,7-8H2,(H,27,30)(H,28,29)/b16-14+ |
| InChIKey | UBHHBUVGAVTLKR-JQIJEIRASA-N |
| XLogP | 5.41 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|