C18H13FN2O4S — CID 39725906
methyl 2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 39725906) has the molecular formula C18H13FN2O4S and a molecular weight of 372.38 g/mol. Its IUPAC name is methyl 2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 39725906 |
| Molecular Formula | C18H13FN2O4S |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | methyl 2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NC(=O)/C=C/c2ccc(-c3ccccc3F)o2)s1 |
| InChI | InChI=1S/C18H13FN2O4S/c1-24-17(23)15-10-20-18(26-15)21-16(22)9-7-11-6-8-14(25-11)12-4-2-3-5-13(12)19/h2-10H,1H3,(H,20,21,22)/b9-7+ |
| InChIKey | XFOUVBSWZULSLX-VQHVLOKHSA-N |
| XLogP | 3.98 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|