C10H12N2O3S — CID 30709011
methyl 2-(3-methylbut-2-enoylamino)-1,3-thiazole-5-carboxylate (PubChem CID 30709011) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is methyl 2-(3-methylbut-2-enoylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(3-methylbut-2-enoylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 30709011 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | methyl 2-(3-methylbut-2-enoylamino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NC(=O)C=C(C)C)s1 |
| InChI | InChI=1S/C10H12N2O3S/c1-6(2)4-8(13)12-10-11-5-7(16-10)9(14)15-3/h4-5H,1-3H3,(H,11,12,13) |
| InChIKey | WRDVAAHCCUSJJO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|