C17H24N2O3S3 — CID 39999696
4-(1,3-dithian-2-yl)-N-(1-methylsulfonylpiperidin-4-yl)benzamide (PubChem CID 39999696) has the molecular formula C17H24N2O3S3 and a molecular weight of 400.59 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-N-(1-methylsulfonylpiperidin-4-yl)benzamide.
| Compound Name | 4-(1,3-dithian-2-yl)-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 39999696 |
| Molecular Formula | C17H24N2O3S3 |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)c2ccc(C3SCCCS3)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O3S3/c1-25(21,22)19-9-7-15(8-10-19)18-16(20)13-3-5-14(6-4-13)17-23-11-2-12-24-17/h3-6,15,17H,2,7-12H2,1H3,(H,18,20) |
| InChIKey | JDFFJIIVNJHYEF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |