C13H16O3S — CID 62390362
(1,1-dioxothiolan-3-yl)-(2-ethylphenyl)methanone (PubChem CID 62390362) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(2-ethylphenyl)methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-(2-ethylphenyl)methanone |
|---|---|
| PubChem CID | 62390362 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(2-ethylphenyl)methanone |
| SMILES | CCc1ccccc1C(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16O3S/c1-2-10-5-3-4-6-12(10)13(14)11-7-8-17(15,16)9-11/h3-6,11H,2,7-9H2,1H3 |
| InChIKey | FYTLVVBVCZHWKH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |