C13H16O4S — CID 113289660
(1,1-dioxothiolan-3-yl)-(4-methoxy-2-methylphenyl)methanone (PubChem CID 113289660) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(4-methoxy-2-methylphenyl)methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-(4-methoxy-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 113289660 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(4-methoxy-2-methylphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C13H16O4S/c1-9-7-11(17-2)3-4-12(9)13(14)10-5-6-18(15,16)8-10/h3-4,7,10H,5-6,8H2,1-2H3 |
| InChIKey | JKTWNOFCCLFCKG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |