C10H12O4S — CID 64913805
(1,1-dioxothiolan-3-yl)-(5-methylfuran-2-yl)methanone (PubChem CID 64913805) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(5-methylfuran-2-yl)methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-(5-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 64913805 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(5-methylfuran-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)C2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C10H12O4S/c1-7-2-3-9(14-7)10(11)8-4-5-15(12,13)6-8/h2-3,8H,4-6H2,1H3 |
| InChIKey | DBAFMOUWCUPPRK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |