C15H15NO3S — CID 115336329
(1,1-dioxothiolan-3-yl)-(2-methylquinolin-6-yl)methanone (PubChem CID 115336329) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(2-methylquinolin-6-yl)methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-(2-methylquinolin-6-yl)methanone |
|---|---|
| PubChem CID | 115336329 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(2-methylquinolin-6-yl)methanone |
| SMILES | Cc1ccc2cc(C(=O)C3CCS(=O)(=O)C3)ccc2n1 |
| InChI | InChI=1S/C15H15NO3S/c1-10-2-3-11-8-12(4-5-14(11)16-10)15(17)13-6-7-20(18,19)9-13/h2-5,8,13H,6-7,9H2,1H3 |
| InChIKey | OZAVEFLLIZWTEJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |