C14H16O4S — CID 114744329
3,4-dihydro-2H-chromen-8-yl-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 114744329) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-8-yl-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | 3,4-dihydro-2H-chromen-8-yl-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 114744329 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3,4-dihydro-2H-chromen-8-yl-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | O=C(c1cccc2c1OCCC2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16O4S/c15-13(11-6-8-19(16,17)9-11)12-5-1-3-10-4-2-7-18-14(10)12/h1,3,5,11H,2,4,6-9H2 |
| InChIKey | LBXSXESKMDYXNK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |