C21H25NO3S — CID 41073361
2-benzyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylbenzamide (PubChem CID 41073361) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 2-benzyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylbenzamide.
| Compound Name | 2-benzyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylbenzamide |
|---|---|
| PubChem CID | 41073361 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-benzyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylbenzamide |
| SMILES | CCCN(C(=O)c1ccccc1Cc1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H25NO3S/c1-2-13-22(19-12-14-26(24,25)16-19)21(23)20-11-7-6-10-18(20)15-17-8-4-3-5-9-17/h3-11,19H,2,12-16H2,1H3/t19-/m1/s1 |
| InChIKey | GUICZPAMJSQYRY-LJQANCHMSA-N |
| XLogP | 3.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |