C22H28N2O3S — CID 112800265
2-(N-benzylanilino)-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide (PubChem CID 112800265) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-(N-benzylanilino)-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide.
| Compound Name | 2-(N-benzylanilino)-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide |
|---|---|
| PubChem CID | 112800265 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(N-benzylanilino)-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide |
| SMILES | CCCN(C(=O)CN(Cc1ccccc1)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H28N2O3S/c1-2-14-24(21-13-15-28(26,27)18-21)22(25)17-23(20-11-7-4-8-12-20)16-19-9-5-3-6-10-19/h3-12,21H,2,13-18H2,1H3 |
| InChIKey | YHSCXDDAJSQTQK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |