C13H15FN2O4S — CID 49165322
N-[2-(4-fluoroanilino)-2-oxoethyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 49165322) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[2-(4-fluoroanilino)-2-oxoethyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[2-(4-fluoroanilino)-2-oxoethyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 49165322 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-[2-(4-fluoroanilino)-2-oxoethyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(CNC(=O)C1CCS(=O)(=O)C1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O4S/c14-10-1-3-11(4-2-10)16-12(17)7-15-13(18)9-5-6-21(19,20)8-9/h1-4,9H,5-8H2,(H,15,18)(H,16,17) |
| InChIKey | RIDMRDMCJUJPGV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |