C16H20ClNO6S — CID 8736851
[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-[(3R)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 8736851) has the molecular formula C16H20ClNO6S and a molecular weight of 389.86 g/mol. Its IUPAC name is [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-[(3R)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-[(3R)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 8736851 |
| Molecular Formula | C16H20ClNO6S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-[(3R)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | O=C(COC(=O)C[C@@H]1CCS(=O)(=O)C1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO6S/c17-13-1-3-14(4-2-13)23-7-6-18-15(19)10-24-16(20)9-12-5-8-25(21,22)11-12/h1-4,12H,5-11H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | FKMKBSXEIAZDPA-LBPRGKRZSA-N |
| XLogP | 1.20 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|