C14H18N2O6S — CID 95234166
2-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-(4-nitrophenoxy)ethyl]acetamide (PubChem CID 95234166) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-(4-nitrophenoxy)ethyl]acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-(4-nitrophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 95234166 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-(4-nitrophenoxy)ethyl]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NCCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N2O6S/c17-14(9-11-5-8-23(20,21)10-11)15-6-7-22-13-3-1-12(2-4-13)16(18)19/h1-4,11H,5-10H2,(H,15,17)/t11-/m0/s1 |
| InChIKey | YAGSOXWGVYNFNI-NSHDSACASA-N |
| XLogP | 0.91 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|