C18H21NO6S — CID 158521761
(E)-1-(1,1-dioxothiolan-3-yl)-8-(4-nitrophenyl)oct-7-ene-2,6-dione (PubChem CID 158521761) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is (E)-1-(1,1-dioxothiolan-3-yl)-8-(4-nitrophenyl)oct-7-ene-2,6-dione.
| Compound Name | (E)-1-(1,1-dioxothiolan-3-yl)-8-(4-nitrophenyl)oct-7-ene-2,6-dione |
|---|---|
| PubChem CID | 158521761 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (E)-1-(1,1-dioxothiolan-3-yl)-8-(4-nitrophenyl)oct-7-ene-2,6-dione |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)CCCC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H21NO6S/c20-17(9-6-14-4-7-16(8-5-14)19(22)23)2-1-3-18(21)12-15-10-11-26(24,25)13-15/h4-9,15H,1-3,10-13H2/b9-6+ |
| InChIKey | HMHMEIQJVVCKJH-RMKNXTFCSA-N |
| XLogP | 2.74 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|