C14H18ClNO4S2 — CID 51923904
N-[2-(4-chlorophenoxy)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylacetamide (PubChem CID 51923904) has the molecular formula C14H18ClNO4S2 and a molecular weight of 363.89 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylacetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 51923904 |
| Molecular Formula | C14H18ClNO4S2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylacetamide |
| SMILES | O=C(CS[C@H]1CCS(=O)(=O)C1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO4S2/c15-11-1-3-12(4-2-11)20-7-6-16-14(17)9-21-13-5-8-22(18,19)10-13/h1-4,13H,5-10H2,(H,16,17)/t13-/m0/s1 |
| InChIKey | QRRKVFMGYUPDBG-ZDUSSCGKSA-N |
| XLogP | 1.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|