C16H23NO3S2 — CID 52835383
2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-[(3R)-3-phenylbutyl]acetamide (PubChem CID 52835383) has the molecular formula C16H23NO3S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-[(3R)-3-phenylbutyl]acetamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-[(3R)-3-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 52835383 |
| Molecular Formula | C16H23NO3S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-[(3R)-3-phenylbutyl]acetamide |
| SMILES | C[C@H](CCNC(=O)CS[C@H]1CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3S2/c1-13(14-5-3-2-4-6-14)7-9-17-16(18)11-21-15-8-10-22(19,20)12-15/h2-6,13,15H,7-12H2,1H3,(H,17,18)/t13-,15+/m1/s1 |
| InChIKey | VTOXLJZCOCAMNF-HIFRSBDPSA-N |
| XLogP | 2.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |