C18H19NO3S2 — CID 3164029
2-(1,1-dioxothiolan-3-yl)sulfanyl-N-(2-phenylphenyl)acetamide (PubChem CID 3164029) has the molecular formula C18H19NO3S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 3164029 |
| Molecular Formula | C18H19NO3S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-(2-phenylphenyl)acetamide |
| SMILES | O=C(CSC1CCS(=O)(=O)C1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C18H19NO3S2/c20-18(12-23-15-10-11-24(21,22)13-15)19-17-9-5-4-8-16(17)14-6-2-1-3-7-14/h1-9,15H,10-13H2,(H,19,20) |
| InChIKey | LWYXOHGJUUFRGA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |