C16H24N2O — CID 55152746
2-(cyclopropylmethylamino)-N-(3-phenylbutyl)acetamide (PubChem CID 55152746) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-(3-phenylbutyl)acetamide.
| Compound Name | 2-(cyclopropylmethylamino)-N-(3-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 55152746 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-(3-phenylbutyl)acetamide |
| SMILES | CC(CCNC(=O)CNCC1CC1)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O/c1-13(15-5-3-2-4-6-15)9-10-18-16(19)12-17-11-14-7-8-14/h2-6,13-14,17H,7-12H2,1H3,(H,18,19) |
| InChIKey | BFFKKAOLNIZIDS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |