C14H19ClN2O4S — CID 95152617
3-[2-(4-chlorophenoxy)ethyl]-1-[(3R)-1,1-dioxothiolan-3-yl]-1-methylurea (PubChem CID 95152617) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)ethyl]-1-[(3R)-1,1-dioxothiolan-3-yl]-1-methylurea.
| Compound Name | 3-[2-(4-chlorophenoxy)ethyl]-1-[(3R)-1,1-dioxothiolan-3-yl]-1-methylurea |
|---|---|
| PubChem CID | 95152617 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)ethyl]-1-[(3R)-1,1-dioxothiolan-3-yl]-1-methylurea |
| SMILES | CN(C(=O)NCCOc1ccc(Cl)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19ClN2O4S/c1-17(12-6-9-22(19,20)10-12)14(18)16-7-8-21-13-4-2-11(15)3-5-13/h2-5,12H,6-10H2,1H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | ZMLCRPDZLQHPEW-GFCCVEGCSA-N |
| XLogP | 1.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|