C14H22N2O5S — CID 94174512
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[3-(furan-2-ylmethoxy)propyl]-1-methylurea (PubChem CID 94174512) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[3-(furan-2-ylmethoxy)propyl]-1-methylurea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[3-(furan-2-ylmethoxy)propyl]-1-methylurea |
|---|---|
| PubChem CID | 94174512 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[3-(furan-2-ylmethoxy)propyl]-1-methylurea |
| SMILES | CN(C(=O)NCCCOCc1ccco1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H22N2O5S/c1-16(12-5-9-22(18,19)11-12)14(17)15-6-3-7-20-10-13-4-2-8-21-13/h2,4,8,12H,3,5-7,9-11H2,1H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | AABSPKQITBRFJM-GFCCVEGCSA-N |
| XLogP | 1.01 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|