C17H21NO5 — CID 2617358
methyl 2-[[2-(2-cyclopentylacetyl)oxyacetyl]amino]benzoate (PubChem CID 2617358) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl 2-[[2-(2-cyclopentylacetyl)oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2-cyclopentylacetyl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2617358 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl 2-[[2-(2-cyclopentylacetyl)oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)CC1CCCC1 |
| InChI | InChI=1S/C17H21NO5/c1-22-17(21)13-8-4-5-9-14(13)18-15(19)11-23-16(20)10-12-6-2-3-7-12/h4-5,8-9,12H,2-3,6-7,10-11H2,1H3,(H,18,19) |
| InChIKey | UCCUUMMSPGXIMH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |