C22H27NO3 — CID 8506708
[2-(2-methylanilino)-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate (PubChem CID 8506708) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate |
|---|---|
| PubChem CID | 8506708 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-16-7-5-6-8-19(16)23-20(24)15-26-21(25)14-11-17-9-12-18(13-10-17)22(2,3)4/h5-10,12-13H,11,14-15H2,1-4H3,(H,23,24) |
| InChIKey | OGTZVCKNJHOJHT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |