C23H27NO4 — CID 8506747
[2-(4-acetylanilino)-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate (PubChem CID 8506747) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate |
|---|---|
| PubChem CID | 8506747 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)CCc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-16(25)18-8-12-20(13-9-18)24-21(26)15-28-22(27)14-7-17-5-10-19(11-6-17)23(2,3)4/h5-6,8-13H,7,14-15H2,1-4H3,(H,24,26) |
| InChIKey | GXMBVJPQOCAWOP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |