C20H22N2O4 — CID 7043065
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylpropanoate (PubChem CID 7043065) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylpropanoate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 7043065 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylpropanoate |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)COC(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-22(2)20(25)16-9-11-17(12-10-16)21-18(23)14-26-19(24)13-8-15-6-4-3-5-7-15/h3-7,9-12H,8,13-14H2,1-2H3,(H,21,23) |
| InChIKey | CLPBVADCXBMVPL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |