C20H20N2O6 — CID 8609973
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-(2-formylphenoxy)acetate (PubChem CID 8609973) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-(2-formylphenoxy)acetate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8609973 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-(2-formylphenoxy)acetate |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)COC(=O)COc2ccccc2C=O)cc1 |
| InChI | InChI=1S/C20H20N2O6/c1-22(2)20(26)14-7-9-16(10-8-14)21-18(24)12-28-19(25)13-27-17-6-4-3-5-15(17)11-23/h3-11H,12-13H2,1-2H3,(H,21,24) |
| InChIKey | NQAWVHTZGOKKDQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|