C18H21N3O2 — CID 54795591
4-[3-(3-aminophenyl)propanoylamino]-N,N-dimethylbenzamide (PubChem CID 54795591) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-[3-(3-aminophenyl)propanoylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-(3-aminophenyl)propanoylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 54795591 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-[3-(3-aminophenyl)propanoylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)CCc2cccc(N)c2)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-21(2)18(23)14-7-9-16(10-8-14)20-17(22)11-6-13-4-3-5-15(19)12-13/h3-5,7-10,12H,6,11,19H2,1-2H3,(H,20,22) |
| InChIKey | FXDAXRCLURFQKH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|