C24H31NO3 — CID 2336459
[2-(2-methylanilino)-2-oxoethyl] 3,5-ditert-butylbenzoate (PubChem CID 2336459) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 3,5-ditert-butylbenzoate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 2336459 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 3,5-ditert-butylbenzoate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H31NO3/c1-16-10-8-9-11-20(16)25-21(26)15-28-22(27)17-12-18(23(2,3)4)14-19(13-17)24(5,6)7/h8-14H,15H2,1-7H3,(H,25,26) |
| InChIKey | IBRMBTWCWIRSFV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |