C23H29NO3 — CID 2334500
(2-anilino-2-oxoethyl) 3,5-ditert-butylbenzoate (PubChem CID 2334500) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 3,5-ditert-butylbenzoate.
| Compound Name | (2-anilino-2-oxoethyl) 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 2334500 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2-anilino-2-oxoethyl) 3,5-ditert-butylbenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)OCC(=O)Nc2ccccc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H29NO3/c1-22(2,3)17-12-16(13-18(14-17)23(4,5)6)21(26)27-15-20(25)24-19-10-8-7-9-11-19/h7-14H,15H2,1-6H3,(H,24,25) |
| InChIKey | SFEXEMMQIXTFBJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |