C23H21N3O3S — CID 19059156
[2-(2-methylanilino)-2-oxoethyl] 4-(phenylcarbamothioylamino)benzoate (PubChem CID 19059156) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 4-(phenylcarbamothioylamino)benzoate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 4-(phenylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19059156 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 4-(phenylcarbamothioylamino)benzoate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)c1ccc(NC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O3S/c1-16-7-5-6-10-20(16)26-21(27)15-29-22(28)17-11-13-19(14-12-17)25-23(30)24-18-8-3-2-4-9-18/h2-14H,15H2,1H3,(H,26,27)(H2,24,25,30) |
| InChIKey | CAOVRDLEGWYGTC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|