C24H21N3O4S — CID 19059169
[2-(4-acetylanilino)-2-oxoethyl] 4-(phenylcarbamothioylamino)benzoate (PubChem CID 19059169) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 4-(phenylcarbamothioylamino)benzoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 4-(phenylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19059169 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 4-(phenylcarbamothioylamino)benzoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)c2ccc(NC(=S)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O4S/c1-16(28)17-7-11-20(12-8-17)25-22(29)15-31-23(30)18-9-13-21(14-10-18)27-24(32)26-19-5-3-2-4-6-19/h2-14H,15H2,1H3,(H,25,29)(H2,26,27,32) |
| InChIKey | OCVMNDPEXZWOHM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|