C17H18N4O4 — CID 9196552
[2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 9196552) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 9196552 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)COC(=O)c1cnccn1 |
| InChI | InChI=1S/C17H18N4O4/c1-2-12-5-3-4-6-13(12)21-15(22)10-20-16(23)11-25-17(24)14-9-18-7-8-19-14/h3-9H,2,10-11H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | ZBRTYNPVAPZQDU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |