C14H11N3O5 — CID 23972998
2-[[2-(pyrazine-2-carbonyloxy)acetyl]amino]benzoic acid (PubChem CID 23972998) has the molecular formula C14H11N3O5 and a molecular weight of 301.26 g/mol. Its IUPAC name is 2-[[2-(pyrazine-2-carbonyloxy)acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-(pyrazine-2-carbonyloxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23972998 |
| Molecular Formula | C14H11N3O5 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[[2-(pyrazine-2-carbonyloxy)acetyl]amino]benzoic acid |
| SMILES | O=C(COC(=O)c1cnccn1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C14H11N3O5/c18-12(8-22-14(21)11-7-15-5-6-16-11)17-10-4-2-1-3-9(10)13(19)20/h1-7H,8H2,(H,17,18)(H,19,20) |
| InChIKey | HSLHWNZXGATHRQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |